C20H23N3OS — CID 171128434
5-[[1-(4-tert-butylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-imino-1,3-thiazolidin-4-one (PubChem CID 171128434) has the molecular formula C20H23N3OS and a molecular weight of 353.49 g/mol. Its IUPAC name is 5-[[1-(4-tert-butylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-imino-1,3-thiazolidin-4-one.
| Compound Name | 5-[[1-(4-tert-butylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 171128434 |
| Molecular Formula | C20H23N3OS |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 5-[[1-(4-tert-butylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-2-imino-1,3-thiazolidin-4-one |
| SMILES | [H]/N=C1/NC(=O)C(=Cc2cc(C)n(-c3ccc(C(C)(C)C)cc3)c2C)S1 |
| InChI | InChI=1S/C20H23N3OS/c1-12-10-14(11-17-18(24)22-19(21)25-17)13(2)23(12)16-8-6-15(7-9-16)20(3,4)5/h6-11H,1-5H3,(H2,21,22,24) |
| InChIKey | PCAQESRXUODHNF-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 57.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|