C23H18FNO3 — CID 171131731
4-[[2-[(4-fluorophenyl)methoxy]cyclohexa-1,3-dien-1-yl]methylidene]-3-phenyl-1,2-oxazol-5-one (PubChem CID 171131731) has the molecular formula C23H18FNO3 and a molecular weight of 375.40 g/mol. Its IUPAC name is 4-[[2-[(4-fluorophenyl)methoxy]cyclohexa-1,3-dien-1-yl]methylidene]-3-phenyl-1,2-oxazol-5-one.
| Compound Name | 4-[[2-[(4-fluorophenyl)methoxy]cyclohexa-1,3-dien-1-yl]methylidene]-3-phenyl-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 171131731 |
| Molecular Formula | C23H18FNO3 |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 4-[[2-[(4-fluorophenyl)methoxy]cyclohexa-1,3-dien-1-yl]methylidene]-3-phenyl-1,2-oxazol-5-one |
| SMILES | O=C1ON=C(c2ccccc2)C1=CC1=C(OCc2ccc(F)cc2)C=CCC1 |
| InChI | InChI=1S/C23H18FNO3/c24-19-12-10-16(11-13-19)15-27-21-9-5-4-8-18(21)14-20-22(25-28-23(20)26)17-6-2-1-3-7-17/h1-3,5-7,9-14H,4,8,15H2 |
| InChIKey | DCTJODYRAJTAGN-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|