C20H18BrClN2O2 — CID 171132427
5-bromo-3-[(3-chlorophenyl)methylidene]-1-(morpholin-4-ylmethyl)indol-2-one (PubChem CID 171132427) has the molecular formula C20H18BrClN2O2 and a molecular weight of 433.73 g/mol. Its IUPAC name is 5-bromo-3-[(3-chlorophenyl)methylidene]-1-(morpholin-4-ylmethyl)indol-2-one.
| Compound Name | 5-bromo-3-[(3-chlorophenyl)methylidene]-1-(morpholin-4-ylmethyl)indol-2-one |
|---|---|
| PubChem CID | 171132427 |
| Molecular Formula | C20H18BrClN2O2 |
| Molecular Weight | 433.73 g/mol |
| Exact Mass | 432.02 |
| IUPAC Name | 5-bromo-3-[(3-chlorophenyl)methylidene]-1-(morpholin-4-ylmethyl)indol-2-one |
| SMILES | O=C1C(=Cc2cccc(Cl)c2)c2cc(Br)ccc2N1CN1CCOCC1 |
| InChI | InChI=1S/C20H18BrClN2O2/c21-15-4-5-19-17(12-15)18(11-14-2-1-3-16(22)10-14)20(25)24(19)13-23-6-8-26-9-7-23/h1-5,10-12H,6-9,13H2 |
| InChIKey | IUHGJBKLHPYKIW-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.73 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|