C22H18N4O5S2 — CID 171134722
N-[3-[4-[[[2-(2,4-dioxo-1,3-thiazolidin-5-ylidene)acetyl]amino]methyl]-5-methyl-1,3-oxazol-2-yl]phenyl]-5-methylthiophene-2-carboxamide (PubChem CID 171134722) has the molecular formula C22H18N4O5S2 and a molecular weight of 482.54 g/mol. Its IUPAC name is N-[3-[4-[[[2-(2,4-dioxo-1,3-thiazolidin-5-ylidene)acetyl]amino]methyl]-5-methyl-1,3-oxazol-2-yl]phenyl]-5-methylthiophene-2-carboxamide.
| Compound Name | N-[3-[4-[[[2-(2,4-dioxo-1,3-thiazolidin-5-ylidene)acetyl]amino]methyl]-5-methyl-1,3-oxazol-2-yl]phenyl]-5-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 171134722 |
| Molecular Formula | C22H18N4O5S2 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.07 |
| IUPAC Name | N-[3-[4-[[[2-(2,4-dioxo-1,3-thiazolidin-5-ylidene)acetyl]amino]methyl]-5-methyl-1,3-oxazol-2-yl]phenyl]-5-methylthiophene-2-carboxamide |
| SMILES | Cc1ccc(C(=O)Nc2cccc(-c3nc(CNC(=O)C=C4SC(=O)NC4=O)c(C)o3)c2)s1 |
| InChI | InChI=1S/C22H18N4O5S2/c1-11-6-7-16(32-11)19(28)24-14-5-3-4-13(8-14)21-25-15(12(2)31-21)10-23-18(27)9-17-20(29)26-22(30)33-17/h3-9H,10H2,1-2H3,(H,23,27)(H,24,28)(H,26,29,30) |
| InChIKey | UXAJNHXIVQAKMP-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 130.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|