C22H29N5 — CID 171134905
3-[2-methyl-6-[4-(3-phenylprop-2-enyl)piperazin-1-yl]pyrimidin-4-yl]cyclobutan-1-amine (PubChem CID 171134905) has the molecular formula C22H29N5 and a molecular weight of 363.51 g/mol. Its IUPAC name is 3-[2-methyl-6-[4-(3-phenylprop-2-enyl)piperazin-1-yl]pyrimidin-4-yl]cyclobutan-1-amine.
| Compound Name | 3-[2-methyl-6-[4-(3-phenylprop-2-enyl)piperazin-1-yl]pyrimidin-4-yl]cyclobutan-1-amine |
|---|---|
| PubChem CID | 171134905 |
| Molecular Formula | C22H29N5 |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | 3-[2-methyl-6-[4-(3-phenylprop-2-enyl)piperazin-1-yl]pyrimidin-4-yl]cyclobutan-1-amine |
| SMILES | Cc1nc(C2CC(N)C2)cc(N2CCN(CC=Cc3ccccc3)CC2)n1 |
| InChI | InChI=1S/C22H29N5/c1-17-24-21(19-14-20(23)15-19)16-22(25-17)27-12-10-26(11-13-27)9-5-8-18-6-3-2-4-7-18/h2-8,16,19-20H,9-15,23H2,1H3 |
| InChIKey | UJFKLCUSPIFXJK-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |