C20H27N5O — CID 91787750
3-[2-methyl-6-[4-(pyridin-2-ylmethoxy)piperidin-1-yl]pyrimidin-4-yl]cyclobutan-1-amine (PubChem CID 91787750) has the molecular formula C20H27N5O and a molecular weight of 353.47 g/mol. Its IUPAC name is 3-[2-methyl-6-[4-(pyridin-2-ylmethoxy)piperidin-1-yl]pyrimidin-4-yl]cyclobutan-1-amine.
| Compound Name | 3-[2-methyl-6-[4-(pyridin-2-ylmethoxy)piperidin-1-yl]pyrimidin-4-yl]cyclobutan-1-amine |
|---|---|
| PubChem CID | 91787750 |
| Molecular Formula | C20H27N5O |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | 3-[2-methyl-6-[4-(pyridin-2-ylmethoxy)piperidin-1-yl]pyrimidin-4-yl]cyclobutan-1-amine |
| SMILES | Cc1nc(C2CC(N)C2)cc(N2CCC(OCc3ccccn3)CC2)n1 |
| InChI | InChI=1S/C20H27N5O/c1-14-23-19(15-10-16(21)11-15)12-20(24-14)25-8-5-18(6-9-25)26-13-17-4-2-3-7-22-17/h2-4,7,12,15-16,18H,5-6,8-11,13,21H2,1H3 |
| InChIKey | HQFBBPVHDCEYBX-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 77.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |