About 3-[6-(4,4-difluoropiperidin-1-yl)-2-methylpyrimidin-4-yl]cyclobutan-1-amine
3-[6-(4,4-difluoropiperidin-1-yl)-2-methylpyrimidin-4-yl]cyclobutan-1-amine (PubChem CID 91796183) has the molecular formula C14H20F2N4
and a molecular weight of 282.34 g/mol. Its IUPAC name is 3-[6-(4,4-difluoropiperidin-1-yl)-2-methylpyrimidin-4-yl]cyclobutan-1-amine.
Molecular Properties
| Compound Name | 3-[6-(4,4-difluoropiperidin-1-yl)-2-methylpyrimidin-4-yl]cyclobutan-1-amine |
| PubChem CID | 91796183 |
| Molecular Formula | C14H20F2N4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 3-[6-(4,4-difluoropiperidin-1-yl)-2-methylpyrimidin-4-yl]cyclobutan-1-amine |
| SMILES | Cc1nc(C2CC(N)C2)cc(N2CCC(F)(F)CC2)n1 |
| InChI | InChI=1S/C14H20F2N4/c1-9-18-12(10-6-11(17)7-10)8-13(19-9)20-4-2-14(15,16)3-5-20/h8,10-11H,2-7,17H2,1H3 |
| InChIKey | AWEHICAZKVEJPR-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[6-(4,4-difluoropiperidin-1-yl)-2-methylpyrimidin-4-yl]cyclobutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[6-(4,4-difluoropiperidin-1-yl)-2-methylpyrimidin-4-yl]cyclobutan-1-amine?
The IUPAC name of 3-[6-(4,4-difluoropiperidin-1-yl)-2-methylpyrimidin-4-yl]cyclobutan-1-amine (CID 91796183) is 3-[6-(4,4-difluoropiperidin-1-yl)-2-methylpyrimidin-4-yl]cyclobutan-1-amine.
What is the SMILES notation for 3-[6-(4,4-difluoropiperidin-1-yl)-2-methylpyrimidin-4-yl]cyclobutan-1-amine?
The canonical SMILES for 3-[6-(4,4-difluoropiperidin-1-yl)-2-methylpyrimidin-4-yl]cyclobutan-1-amine is Cc1nc(C2CC(N)C2)cc(N2CCC(F)(F)CC2)n1.
What is the InChIKey of 3-[6-(4,4-difluoropiperidin-1-yl)-2-methylpyrimidin-4-yl]cyclobutan-1-amine?
The InChIKey is AWEHICAZKVEJPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20F2N4/c1-9-18-12(10-6-11(17)7-10)8-13(19-9)20-4-2-14(15,16)3-5-20/h8,10-11H,2-7,17H2,1H3.
What are the key properties of 3-[6-(4,4-difluoropiperidin-1-yl)-2-methylpyrimidin-4-yl]cyclobutan-1-amine?
3-[6-(4,4-difluoropiperidin-1-yl)-2-methylpyrimidin-4-yl]cyclobutan-1-amine has a molecular weight of 282.34 g/mol, XLogP of 2.23, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[6-(4,4-difluoropiperidin-1-yl)-2-methylpyrimidin-4-yl]cyclobutan-1-amine is sourced from PubChem (CID 91796183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).