C20H24N4O — CID 171135029
1-[4-(2-pyridin-2-ylethenyl)phenyl]-3-(2-pyrrolidin-1-ylethyl)urea (PubChem CID 171135029) has the molecular formula C20H24N4O and a molecular weight of 336.44 g/mol. Its IUPAC name is 1-[4-(2-pyridin-2-ylethenyl)phenyl]-3-(2-pyrrolidin-1-ylethyl)urea.
| Compound Name | 1-[4-(2-pyridin-2-ylethenyl)phenyl]-3-(2-pyrrolidin-1-ylethyl)urea |
|---|---|
| PubChem CID | 171135029 |
| Molecular Formula | C20H24N4O |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 1-[4-(2-pyridin-2-ylethenyl)phenyl]-3-(2-pyrrolidin-1-ylethyl)urea |
| SMILES | O=C(NCCN1CCCC1)Nc1ccc(C=Cc2ccccn2)cc1 |
| InChI | InChI=1S/C20H24N4O/c25-20(22-13-16-24-14-3-4-15-24)23-19-10-7-17(8-11-19)6-9-18-5-1-2-12-21-18/h1-2,5-12H,3-4,13-16H2,(H2,22,23,25) |
| InChIKey | WINSECXAVUHWBS-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |