C21H25ClN2O — CID 5240562
1-(6-chlorohexyl)-3-[4-(2-phenylethenyl)phenyl]urea (PubChem CID 5240562) has the molecular formula C21H25ClN2O and a molecular weight of 356.90 g/mol. Its IUPAC name is 1-(6-chlorohexyl)-3-[4-(2-phenylethenyl)phenyl]urea.
| Compound Name | 1-(6-chlorohexyl)-3-[4-(2-phenylethenyl)phenyl]urea |
|---|---|
| PubChem CID | 5240562 |
| Molecular Formula | C21H25ClN2O |
| Molecular Weight | 356.90 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 1-(6-chlorohexyl)-3-[4-(2-phenylethenyl)phenyl]urea |
| SMILES | O=C(NCCCCCCCl)Nc1ccc(C=Cc2ccccc2)cc1 |
| InChI | InChI=1S/C21H25ClN2O/c22-16-6-1-2-7-17-23-21(25)24-20-14-12-19(13-15-20)11-10-18-8-4-3-5-9-18/h3-5,8-15H,1-2,6-7,16-17H2,(H2,23,24,25) |
| InChIKey | AJGSWVNIZUFPGO-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.90 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|