C20H23ClN2O4 — CID 122181272
1-(2-chloroethyl)-3-[4-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]urea (PubChem CID 122181272) has the molecular formula C20H23ClN2O4 and a molecular weight of 390.87 g/mol. Its IUPAC name is 1-(2-chloroethyl)-3-[4-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]urea.
| Compound Name | 1-(2-chloroethyl)-3-[4-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]urea |
|---|---|
| PubChem CID | 122181272 |
| Molecular Formula | C20H23ClN2O4 |
| Molecular Weight | 390.87 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 1-(2-chloroethyl)-3-[4-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]urea |
| SMILES | COc1cc(/C=C/c2ccc(NC(=O)NCCCl)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C20H23ClN2O4/c1-25-17-12-15(13-18(26-2)19(17)27-3)5-4-14-6-8-16(9-7-14)23-20(24)22-11-10-21/h4-9,12-13H,10-11H2,1-3H3,(H2,22,23,24)/b5-4+ |
| InChIKey | QIUGSQOYQJHXAQ-SNAWJCMRSA-N |
| XLogP | 4.24 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.87 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|