C24H35N3O4 — CID 171135766
2-[(16S,17S)-4-ethyl-2-oxo-12-oxa-1,4-diazatricyclo[14.3.1.06,11]icosa-6,8,10,14-tetraen-17-yl]-N-(2-methoxyethyl)acetamide (PubChem CID 171135766) has the molecular formula C24H35N3O4 and a molecular weight of 429.56 g/mol. Its IUPAC name is 2-[(16S,17S)-4-ethyl-2-oxo-12-oxa-1,4-diazatricyclo[14.3.1.06,11]icosa-6,8,10,14-tetraen-17-yl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[(16S,17S)-4-ethyl-2-oxo-12-oxa-1,4-diazatricyclo[14.3.1.06,11]icosa-6,8,10,14-tetraen-17-yl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 171135766 |
| Molecular Formula | C24H35N3O4 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.26 |
| IUPAC Name | 2-[(16S,17S)-4-ethyl-2-oxo-12-oxa-1,4-diazatricyclo[14.3.1.06,11]icosa-6,8,10,14-tetraen-17-yl]-N-(2-methoxyethyl)acetamide |
| SMILES | CCN1CC(=O)N2CC[C@@H](CC(=O)NCCOC)[C@@H](C=CCOc3ccccc3C1)C2 |
| InChI | InChI=1S/C24H35N3O4/c1-3-26-16-21-7-4-5-9-22(21)31-13-6-8-20-17-27(24(29)18-26)12-10-19(20)15-23(28)25-11-14-30-2/h4-9,19-20H,3,10-18H2,1-2H3,(H,25,28)/t19-,20-/m0/s1 |
| InChIKey | GHJRBHIQDURWOO-PMACEKPBSA-N |
| XLogP | 2.07 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|