C22H31N3O4 — CID 122165596
N-(2-methoxyethyl)-2-[(14Z,16S,17S)-2-oxo-12-oxa-1,4-diazatricyclo[14.3.1.06,11]icosa-6,8,10,14-tetraen-17-yl]acetamide (PubChem CID 122165596) has the molecular formula C22H31N3O4 and a molecular weight of 401.51 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-[(14Z,16S,17S)-2-oxo-12-oxa-1,4-diazatricyclo[14.3.1.06,11]icosa-6,8,10,14-tetraen-17-yl]acetamide.
| Compound Name | N-(2-methoxyethyl)-2-[(14Z,16S,17S)-2-oxo-12-oxa-1,4-diazatricyclo[14.3.1.06,11]icosa-6,8,10,14-tetraen-17-yl]acetamide |
|---|---|
| PubChem CID | 122165596 |
| Molecular Formula | C22H31N3O4 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.23 |
| IUPAC Name | N-(2-methoxyethyl)-2-[(14Z,16S,17S)-2-oxo-12-oxa-1,4-diazatricyclo[14.3.1.06,11]icosa-6,8,10,14-tetraen-17-yl]acetamide |
| SMILES | COCCNC(=O)C[C@@H]1CCN2C[C@@H]1/C=C\COc1ccccc1CNCC2=O |
| InChI | InChI=1S/C22H31N3O4/c1-28-12-9-24-21(26)13-17-8-10-25-16-19(17)6-4-11-29-20-7-3-2-5-18(20)14-23-15-22(25)27/h2-7,17,19,23H,8-16H2,1H3,(H,24,26)/b6-4-/t17-,19-/m0/s1 |
| InChIKey | WMTMRWZMIWBZQP-GNRZLHGISA-N |
| XLogP | 1.34 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|