C27H40N6O3 — CID 71692895
(14E,16S,17S)-17-(2-oxo-2-piperazin-1-ylethyl)-8-piperazin-1-yl-12-oxa-1,4-diazatricyclo[14.3.1.06,11]icosa-6(11),7,9,14-tetraen-2-one (PubChem CID 71692895) has the molecular formula C27H40N6O3 and a molecular weight of 496.66 g/mol. Its IUPAC name is (14E,16S,17S)-17-(2-oxo-2-piperazin-1-ylethyl)-8-piperazin-1-yl-12-oxa-1,4-diazatricyclo[14.3.1.06,11]icosa-6(11),7,9,14-tetraen-2-one.
| Compound Name | (14E,16S,17S)-17-(2-oxo-2-piperazin-1-ylethyl)-8-piperazin-1-yl-12-oxa-1,4-diazatricyclo[14.3.1.06,11]icosa-6(11),7,9,14-tetraen-2-one |
|---|---|
| PubChem CID | 71692895 |
| Molecular Formula | C27H40N6O3 |
| Molecular Weight | 496.66 g/mol |
| Exact Mass | 496.32 |
| IUPAC Name | (14E,16S,17S)-17-(2-oxo-2-piperazin-1-ylethyl)-8-piperazin-1-yl-12-oxa-1,4-diazatricyclo[14.3.1.06,11]icosa-6(11),7,9,14-tetraen-2-one |
| SMILES | O=C(C[C@@H]1CCN2C[C@@H]1/C=C\COc1ccc(N3CCNCC3)cc1CNCC2=O)N1CCNCC1 |
| InChI | InChI=1S/C27H40N6O3/c34-26(32-13-8-29-9-14-32)17-21-5-10-33-20-22(21)2-1-15-36-25-4-3-24(31-11-6-28-7-12-31)16-23(25)18-30-19-27(33)35/h1-4,16,21-22,28-30H,5-15,17-20H2/b2-1-/t21-,22-/m0/s1 |
| InChIKey | KXHTZIMCDWVMCL-AUSJAXNVSA-N |
| XLogP | 0.42 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.66 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|