C30H48N6O4 — CID 56776138
2-[(14Z,16S,17S)-8-[2-(dimethylamino)ethyl-methylamino]-2-oxo-12-oxa-1,4-diazatricyclo[14.3.1.06,11]icosa-6(11),7,9,14-tetraen-17-yl]-N-(2-morpholin-4-ylethyl)acetamide (PubChem CID 56776138) has the molecular formula C30H48N6O4 and a molecular weight of 556.75 g/mol. Its IUPAC name is 2-[(14Z,16S,17S)-8-[2-(dimethylamino)ethyl-methylamino]-2-oxo-12-oxa-1,4-diazatricyclo[14.3.1.06,11]icosa-6(11),7,9,14-tetraen-17-yl]-N-(2-morpholin-4-ylethyl)acetamide.
| Compound Name | 2-[(14Z,16S,17S)-8-[2-(dimethylamino)ethyl-methylamino]-2-oxo-12-oxa-1,4-diazatricyclo[14.3.1.06,11]icosa-6(11),7,9,14-tetraen-17-yl]-N-(2-morpholin-4-ylethyl)acetamide |
|---|---|
| PubChem CID | 56776138 |
| Molecular Formula | C30H48N6O4 |
| Molecular Weight | 556.75 g/mol |
| Exact Mass | 556.37 |
| IUPAC Name | 2-[(14Z,16S,17S)-8-[2-(dimethylamino)ethyl-methylamino]-2-oxo-12-oxa-1,4-diazatricyclo[14.3.1.06,11]icosa-6(11),7,9,14-tetraen-17-yl]-N-(2-morpholin-4-ylethyl)acetamide |
| SMILES | CN(C)CCN(C)c1ccc2c(c1)CNCC(=O)N1CC[C@@H](CC(=O)NCCN3CCOCC3)[C@@H](/C=C\CO2)C1 |
| InChI | InChI=1S/C30H48N6O4/c1-33(2)12-13-34(3)27-6-7-28-26(19-27)21-31-22-30(38)36-10-8-24(25(23-36)5-4-16-40-28)20-29(37)32-9-11-35-14-17-39-18-15-35/h4-7,19,24-25,31H,8-18,20-23H2,1-3H3,(H,32,37)/b5-4-/t24-,25-/m0/s1 |
| InChIKey | XQXDOYMLSYYWHT-BNPWMUJRSA-N |
| XLogP | 1.03 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.75 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|