C31H42N6O4 — CID 171156288
N-(2-acetamidoethyl)-2-[(16S,17S)-8-[methyl(2-pyridin-2-ylethyl)amino]-2-oxo-12-oxa-1,4-diazatricyclo[14.3.1.06,11]icosa-6(11),7,9,14-tetraen-17-yl]acetamide (PubChem CID 171156288) has the molecular formula C31H42N6O4 and a molecular weight of 562.72 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-2-[(16S,17S)-8-[methyl(2-pyridin-2-ylethyl)amino]-2-oxo-12-oxa-1,4-diazatricyclo[14.3.1.06,11]icosa-6(11),7,9,14-tetraen-17-yl]acetamide.
| Compound Name | N-(2-acetamidoethyl)-2-[(16S,17S)-8-[methyl(2-pyridin-2-ylethyl)amino]-2-oxo-12-oxa-1,4-diazatricyclo[14.3.1.06,11]icosa-6(11),7,9,14-tetraen-17-yl]acetamide |
|---|---|
| PubChem CID | 171156288 |
| Molecular Formula | C31H42N6O4 |
| Molecular Weight | 562.72 g/mol |
| Exact Mass | 562.33 |
| IUPAC Name | N-(2-acetamidoethyl)-2-[(16S,17S)-8-[methyl(2-pyridin-2-ylethyl)amino]-2-oxo-12-oxa-1,4-diazatricyclo[14.3.1.06,11]icosa-6(11),7,9,14-tetraen-17-yl]acetamide |
| SMILES | CC(=O)NCCNC(=O)C[C@@H]1CCN2C[C@@H]1C=CCOc1ccc(N(C)CCc3ccccn3)cc1CNCC2=O |
| InChI | InChI=1S/C31H42N6O4/c1-23(38)33-13-14-35-30(39)19-24-10-16-37-22-25(24)6-5-17-41-29-9-8-28(18-26(29)20-32-21-31(37)40)36(2)15-11-27-7-3-4-12-34-27/h3-9,12,18,24-25,32H,10-11,13-17,19-22H2,1-2H3,(H,33,38)(H,35,39)/t24-,25-/m0/s1 |
| InChIKey | GWCPWTHLBZADKO-DQEYMECFSA-N |
| XLogP | 1.91 |
| TPSA | 115.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.72 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|