C30H44N6O3 — CID 95790523
2-[(16R,17S)-8-[2-(dimethylamino)ethyl-methylamino]-2-oxo-12-oxa-1,4-diazatricyclo[14.3.1.06,11]icosa-6(11),7,9-trien-17-yl]-N-(pyridin-3-ylmethyl)acetamide (PubChem CID 95790523) has the molecular formula C30H44N6O3 and a molecular weight of 536.72 g/mol. Its IUPAC name is 2-[(16R,17S)-8-[2-(dimethylamino)ethyl-methylamino]-2-oxo-12-oxa-1,4-diazatricyclo[14.3.1.06,11]icosa-6(11),7,9-trien-17-yl]-N-(pyridin-3-ylmethyl)acetamide.
| Compound Name | 2-[(16R,17S)-8-[2-(dimethylamino)ethyl-methylamino]-2-oxo-12-oxa-1,4-diazatricyclo[14.3.1.06,11]icosa-6(11),7,9-trien-17-yl]-N-(pyridin-3-ylmethyl)acetamide |
|---|---|
| PubChem CID | 95790523 |
| Molecular Formula | C30H44N6O3 |
| Molecular Weight | 536.72 g/mol |
| Exact Mass | 536.35 |
| IUPAC Name | 2-[(16R,17S)-8-[2-(dimethylamino)ethyl-methylamino]-2-oxo-12-oxa-1,4-diazatricyclo[14.3.1.06,11]icosa-6(11),7,9-trien-17-yl]-N-(pyridin-3-ylmethyl)acetamide |
| SMILES | CN(C)CCN(C)c1ccc2c(c1)CNCC(=O)N1CC[C@@H](CC(=O)NCc3cccnc3)[C@@H](CCCO2)C1 |
| InChI | InChI=1S/C30H44N6O3/c1-34(2)13-14-35(3)27-8-9-28-26(16-27)20-32-21-30(38)36-12-10-24(25(22-36)7-5-15-39-28)17-29(37)33-19-23-6-4-11-31-18-23/h4,6,8-9,11,16,18,24-25,32H,5,7,10,12-15,17,19-22H2,1-3H3,(H,33,37)/t24-,25-/m0/s1 |
| InChIKey | VUKXRYFYUYWBMF-DQEYMECFSA-N |
| XLogP | 2.51 |
| TPSA | 90.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.72 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|