C31H46N6O3 — CID 56776143
2-[(16R,17S)-8-[2-(dimethylamino)ethyl-methylamino]-2-oxo-12-oxa-1,4-diazatricyclo[14.3.1.06,11]icosa-6(11),7,9-trien-17-yl]-N-methyl-N-(pyridin-3-ylmethyl)acetamide (PubChem CID 56776143) has the molecular formula C31H46N6O3 and a molecular weight of 550.75 g/mol. Its IUPAC name is 2-[(16R,17S)-8-[2-(dimethylamino)ethyl-methylamino]-2-oxo-12-oxa-1,4-diazatricyclo[14.3.1.06,11]icosa-6(11),7,9-trien-17-yl]-N-methyl-N-(pyridin-3-ylmethyl)acetamide.
| Compound Name | 2-[(16R,17S)-8-[2-(dimethylamino)ethyl-methylamino]-2-oxo-12-oxa-1,4-diazatricyclo[14.3.1.06,11]icosa-6(11),7,9-trien-17-yl]-N-methyl-N-(pyridin-3-ylmethyl)acetamide |
|---|---|
| PubChem CID | 56776143 |
| Molecular Formula | C31H46N6O3 |
| Molecular Weight | 550.75 g/mol |
| Exact Mass | 550.36 |
| IUPAC Name | 2-[(16R,17S)-8-[2-(dimethylamino)ethyl-methylamino]-2-oxo-12-oxa-1,4-diazatricyclo[14.3.1.06,11]icosa-6(11),7,9-trien-17-yl]-N-methyl-N-(pyridin-3-ylmethyl)acetamide |
| SMILES | CN(C)CCN(C)c1ccc2c(c1)CNCC(=O)N1CC[C@@H](CC(=O)N(C)Cc3cccnc3)[C@@H](CCCO2)C1 |
| InChI | InChI=1S/C31H46N6O3/c1-34(2)14-15-35(3)28-9-10-29-27(17-28)20-33-21-31(39)37-13-11-25(26(23-37)8-6-16-40-29)18-30(38)36(4)22-24-7-5-12-32-19-24/h5,7,9-10,12,17,19,25-26,33H,6,8,11,13-16,18,20-23H2,1-4H3/t25-,26-/m0/s1 |
| InChIKey | GAKLZPYOVQJEJA-UIOOFZCWSA-N |
| XLogP | 2.86 |
| TPSA | 81.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.75 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|