C33H46N4O6 — CID 71692865
N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[(16R,17S)-8-morpholin-4-yl-2-oxo-12-oxa-1,4-diazatricyclo[14.3.1.06,11]icosa-6(11),7,9-trien-17-yl]acetamide (PubChem CID 71692865) has the molecular formula C33H46N4O6 and a molecular weight of 594.75 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[(16R,17S)-8-morpholin-4-yl-2-oxo-12-oxa-1,4-diazatricyclo[14.3.1.06,11]icosa-6(11),7,9-trien-17-yl]acetamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[(16R,17S)-8-morpholin-4-yl-2-oxo-12-oxa-1,4-diazatricyclo[14.3.1.06,11]icosa-6(11),7,9-trien-17-yl]acetamide |
|---|---|
| PubChem CID | 71692865 |
| Molecular Formula | C33H46N4O6 |
| Molecular Weight | 594.75 g/mol |
| Exact Mass | 594.34 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[(16R,17S)-8-morpholin-4-yl-2-oxo-12-oxa-1,4-diazatricyclo[14.3.1.06,11]icosa-6(11),7,9-trien-17-yl]acetamide |
| SMILES | COc1ccc(CCNC(=O)C[C@@H]2CCN3C[C@@H]2CCCOc2ccc(N4CCOCC4)cc2CNCC3=O)cc1OC |
| InChI | InChI=1S/C33H46N4O6/c1-40-30-7-5-24(18-31(30)41-2)9-11-35-32(38)20-25-10-12-37-23-26(25)4-3-15-43-29-8-6-28(36-13-16-42-17-14-36)19-27(29)21-34-22-33(37)39/h5-8,18-19,25-26,34H,3-4,9-17,20-23H2,1-2H3,(H,35,38)/t25-,26-/m0/s1 |
| InChIKey | IVPZSYOHJOYWIU-UIOOFZCWSA-N |
| XLogP | 3.02 |
| TPSA | 101.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.75 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|