C27H41N5O4 — CID 56776123
(16R,17S)-17-(2-morpholin-4-yl-2-oxoethyl)-8-piperazin-1-yl-12-oxa-1,4-diazatricyclo[14.3.1.06,11]icosa-6(11),7,9-trien-2-one (PubChem CID 56776123) has the molecular formula C27H41N5O4 and a molecular weight of 499.66 g/mol. Its IUPAC name is (16R,17S)-17-(2-morpholin-4-yl-2-oxoethyl)-8-piperazin-1-yl-12-oxa-1,4-diazatricyclo[14.3.1.06,11]icosa-6(11),7,9-trien-2-one.
| Compound Name | (16R,17S)-17-(2-morpholin-4-yl-2-oxoethyl)-8-piperazin-1-yl-12-oxa-1,4-diazatricyclo[14.3.1.06,11]icosa-6(11),7,9-trien-2-one |
|---|---|
| PubChem CID | 56776123 |
| Molecular Formula | C27H41N5O4 |
| Molecular Weight | 499.66 g/mol |
| Exact Mass | 499.32 |
| IUPAC Name | (16R,17S)-17-(2-morpholin-4-yl-2-oxoethyl)-8-piperazin-1-yl-12-oxa-1,4-diazatricyclo[14.3.1.06,11]icosa-6(11),7,9-trien-2-one |
| SMILES | O=C(C[C@@H]1CCN2C[C@@H]1CCCOc1ccc(N3CCNCC3)cc1CNCC2=O)N1CCOCC1 |
| InChI | InChI=1S/C27H41N5O4/c33-26(31-11-14-35-15-12-31)17-21-5-8-32-20-22(21)2-1-13-36-25-4-3-24(30-9-6-28-7-10-30)16-23(25)18-29-19-27(32)34/h3-4,16,21-22,28-29H,1-2,5-15,17-20H2/t21-,22-/m0/s1 |
| InChIKey | YMACTZVGLJNEMF-VXKWHMMOSA-N |
| XLogP | 1.07 |
| TPSA | 86.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.66 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|