C29H44N4O4 — CID 86769058
(16R,17S)-17-[2-(4-acetylpiperazin-1-yl)-2-oxoethyl]-4-(2-methylpropyl)-12-oxa-1,4-diazatricyclo[14.3.1.06,11]icosa-6,8,10-trien-2-one (PubChem CID 86769058) has the molecular formula C29H44N4O4 and a molecular weight of 512.70 g/mol. Its IUPAC name is (16R,17S)-17-[2-(4-acetylpiperazin-1-yl)-2-oxoethyl]-4-(2-methylpropyl)-12-oxa-1,4-diazatricyclo[14.3.1.06,11]icosa-6,8,10-trien-2-one.
| Compound Name | (16R,17S)-17-[2-(4-acetylpiperazin-1-yl)-2-oxoethyl]-4-(2-methylpropyl)-12-oxa-1,4-diazatricyclo[14.3.1.06,11]icosa-6,8,10-trien-2-one |
|---|---|
| PubChem CID | 86769058 |
| Molecular Formula | C29H44N4O4 |
| Molecular Weight | 512.70 g/mol |
| Exact Mass | 512.34 |
| IUPAC Name | (16R,17S)-17-[2-(4-acetylpiperazin-1-yl)-2-oxoethyl]-4-(2-methylpropyl)-12-oxa-1,4-diazatricyclo[14.3.1.06,11]icosa-6,8,10-trien-2-one |
| SMILES | CC(=O)N1CCN(C(=O)C[C@@H]2CCN3C[C@@H]2CCCOc2ccccc2CN(CC(C)C)CC3=O)CC1 |
| InChI | InChI=1S/C29H44N4O4/c1-22(2)18-30-19-26-7-4-5-9-27(26)37-16-6-8-25-20-33(29(36)21-30)11-10-24(25)17-28(35)32-14-12-31(13-15-32)23(3)34/h4-5,7,9,22,24-25H,6,8,10-21H2,1-3H3/t24-,25-/m0/s1 |
| InChIKey | HQUWCMCEAOZAMK-DQEYMECFSA-N |
| XLogP | 2.86 |
| TPSA | 73.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.70 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |