C30H39N3O6S — CID 86769081
(16R,17S)-17-[2-[(3R)-3-hydroxypyrrolidin-1-yl]-2-oxoethyl]-4-(4-methylphenyl)sulfonyl-12-oxa-1,4-diazatricyclo[14.3.1.06,11]icosa-6,8,10-trien-2-one (PubChem CID 86769081) has the molecular formula C30H39N3O6S and a molecular weight of 569.72 g/mol. Its IUPAC name is (16R,17S)-17-[2-[(3R)-3-hydroxypyrrolidin-1-yl]-2-oxoethyl]-4-(4-methylphenyl)sulfonyl-12-oxa-1,4-diazatricyclo[14.3.1.06,11]icosa-6,8,10-trien-2-one.
| Compound Name | (16R,17S)-17-[2-[(3R)-3-hydroxypyrrolidin-1-yl]-2-oxoethyl]-4-(4-methylphenyl)sulfonyl-12-oxa-1,4-diazatricyclo[14.3.1.06,11]icosa-6,8,10-trien-2-one |
|---|---|
| PubChem CID | 86769081 |
| Molecular Formula | C30H39N3O6S |
| Molecular Weight | 569.72 g/mol |
| Exact Mass | 569.26 |
| IUPAC Name | (16R,17S)-17-[2-[(3R)-3-hydroxypyrrolidin-1-yl]-2-oxoethyl]-4-(4-methylphenyl)sulfonyl-12-oxa-1,4-diazatricyclo[14.3.1.06,11]icosa-6,8,10-trien-2-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CC(=O)N3CC[C@@H](CC(=O)N4CC[C@@H](O)C4)[C@@H](CCCOc4ccccc4C2)C3)cc1 |
| InChI | InChI=1S/C30H39N3O6S/c1-22-8-10-27(11-9-22)40(37,38)33-19-25-5-2-3-7-28(25)39-16-4-6-24-18-31(30(36)21-33)14-12-23(24)17-29(35)32-15-13-26(34)20-32/h2-3,5,7-11,23-24,26,34H,4,6,12-21H2,1H3/t23-,24-,26+/m0/s1 |
| InChIKey | XFGYLCWGXKRBPQ-KYPHJKQUSA-N |
| XLogP | 2.81 |
| TPSA | 107.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.72 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |