C27H33N3O4 — CID 71692843
N-[2-(4-hydroxyphenyl)ethyl]-2-[(14E,16S,17S)-2-oxo-12-oxa-1,4-diazatricyclo[14.3.1.06,11]icosa-6,8,10,14-tetraen-17-yl]acetamide (PubChem CID 71692843) has the molecular formula C27H33N3O4 and a molecular weight of 463.58 g/mol. Its IUPAC name is N-[2-(4-hydroxyphenyl)ethyl]-2-[(14E,16S,17S)-2-oxo-12-oxa-1,4-diazatricyclo[14.3.1.06,11]icosa-6,8,10,14-tetraen-17-yl]acetamide.
| Compound Name | N-[2-(4-hydroxyphenyl)ethyl]-2-[(14E,16S,17S)-2-oxo-12-oxa-1,4-diazatricyclo[14.3.1.06,11]icosa-6,8,10,14-tetraen-17-yl]acetamide |
|---|---|
| PubChem CID | 71692843 |
| Molecular Formula | C27H33N3O4 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.25 |
| IUPAC Name | N-[2-(4-hydroxyphenyl)ethyl]-2-[(14E,16S,17S)-2-oxo-12-oxa-1,4-diazatricyclo[14.3.1.06,11]icosa-6,8,10,14-tetraen-17-yl]acetamide |
| SMILES | O=C(C[C@@H]1CCN2C[C@@H]1/C=C\COc1ccccc1CNCC2=O)NCCc1ccc(O)cc1 |
| InChI | InChI=1S/C27H33N3O4/c31-24-9-7-20(8-10-24)11-13-29-26(32)16-21-12-14-30-19-23(21)5-3-15-34-25-6-2-1-4-22(25)17-28-18-27(30)33/h1-10,21,23,28,31H,11-19H2,(H,29,32)/b5-3-/t21-,23-/m0/s1 |
| InChIKey | MGVYECDAAFMXDS-UFYILMIMSA-N |
| XLogP | 2.64 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|