C27H39N3O4 — CID 129008837
2-[(16S,17S)-4-cyclopentyl-2-oxo-12-oxa-1,4-diazatricyclo[14.3.1.06,11]icosa-6,8,10,14-tetraen-17-yl]-N-(2-methoxyethyl)acetamide (PubChem CID 129008837) has the molecular formula C27H39N3O4 and a molecular weight of 469.63 g/mol. Its IUPAC name is 2-[(16S,17S)-4-cyclopentyl-2-oxo-12-oxa-1,4-diazatricyclo[14.3.1.06,11]icosa-6,8,10,14-tetraen-17-yl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[(16S,17S)-4-cyclopentyl-2-oxo-12-oxa-1,4-diazatricyclo[14.3.1.06,11]icosa-6,8,10,14-tetraen-17-yl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 129008837 |
| Molecular Formula | C27H39N3O4 |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 469.29 |
| IUPAC Name | 2-[(16S,17S)-4-cyclopentyl-2-oxo-12-oxa-1,4-diazatricyclo[14.3.1.06,11]icosa-6,8,10,14-tetraen-17-yl]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)C[C@@H]1CCN2C[C@@H]1C=CCOc1ccccc1CN(C1CCCC1)CC2=O |
| InChI | InChI=1S/C27H39N3O4/c1-33-16-13-28-26(31)17-21-12-14-29-18-22(21)8-6-15-34-25-11-5-2-7-23(25)19-30(20-27(29)32)24-9-3-4-10-24/h2,5-8,11,21-22,24H,3-4,9-10,12-20H2,1H3,(H,28,31)/t21-,22-/m0/s1 |
| InChIKey | MFCBXRZLHQNRPZ-VXKWHMMOSA-N |
| XLogP | 3.00 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|