C14H20N2O3S — CID 171138583
3-cyano-N,N-diethyl-4-propoxybenzenesulfonamide (PubChem CID 171138583) has the molecular formula C14H20N2O3S and a molecular weight of 296.39 g/mol. Its IUPAC name is 3-cyano-N,N-diethyl-4-propoxybenzenesulfonamide.
| Compound Name | 3-cyano-N,N-diethyl-4-propoxybenzenesulfonamide |
|---|---|
| PubChem CID | 171138583 |
| Molecular Formula | C14H20N2O3S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 3-cyano-N,N-diethyl-4-propoxybenzenesulfonamide |
| SMILES | CCCOc1ccc(S(=O)(=O)N(CC)CC)cc1C#N |
| InChI | InChI=1S/C14H20N2O3S/c1-4-9-19-14-8-7-13(10-12(14)11-15)20(17,18)16(5-2)6-3/h7-8,10H,4-6,9H2,1-3H3 |
| InChIKey | YKAZRIGCARDUSV-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |