C24H28N6OS2 — CID 17113964
2-(1-adamantyl)-N-[[2-methyl-3-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]carbamothioyl]acetamide (PubChem CID 17113964) has the molecular formula C24H28N6OS2 and a molecular weight of 480.66 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-[[2-methyl-3-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]carbamothioyl]acetamide.
| Compound Name | 2-(1-adamantyl)-N-[[2-methyl-3-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]carbamothioyl]acetamide |
|---|---|
| PubChem CID | 17113964 |
| Molecular Formula | C24H28N6OS2 |
| Molecular Weight | 480.66 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | 2-(1-adamantyl)-N-[[2-methyl-3-(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]carbamothioyl]acetamide |
| SMILES | Cc1c(NC(=S)NC(=O)CC23CC4CC(CC(C4)C2)C3)cccc1-c1nn2c(C)nnc2s1 |
| InChI | InChI=1S/C24H28N6OS2/c1-13-18(21-29-30-14(2)27-28-23(30)33-21)4-3-5-19(13)25-22(32)26-20(31)12-24-9-15-6-16(10-24)8-17(7-15)11-24/h3-5,15-17H,6-12H2,1-2H3,(H2,25,26,31,32) |
| InChIKey | DBQCRTZGVVQORN-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 84.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.66 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|