C29H37NO7 — CID 171141081
1-[(1R,4aS,8aS)-1-(3,4-dimethoxyphenyl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one (PubChem CID 171141081) has the molecular formula C29H37NO7 and a molecular weight of 511.62 g/mol. Its IUPAC name is 1-[(1R,4aS,8aS)-1-(3,4-dimethoxyphenyl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one.
| Compound Name | 1-[(1R,4aS,8aS)-1-(3,4-dimethoxyphenyl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 171141081 |
| Molecular Formula | C29H37NO7 |
| Molecular Weight | 511.62 g/mol |
| Exact Mass | 511.26 |
| IUPAC Name | 1-[(1R,4aS,8aS)-1-(3,4-dimethoxyphenyl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc([C@H]2[C@@H]3CCCC[C@]3(O)CCN2C(=O)C=Cc2cc(OC)c(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C29H37NO7/c1-33-22-11-10-20(18-23(22)34-2)27-21-8-6-7-13-29(21,32)14-15-30(27)26(31)12-9-19-16-24(35-3)28(37-5)25(17-19)36-4/h9-12,16-18,21,27,32H,6-8,13-15H2,1-5H3/t21-,27-,29-/m0/s1 |
| InChIKey | GVFGORHLALSXTD-SSKOMTKWSA-N |
| XLogP | 4.64 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.62 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|