C30H39NO5 — CID 4268176
1-[4a-hydroxy-1-(3,4,5-trimethoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-3-(4-propan-2-ylphenyl)prop-2-en-1-one (PubChem CID 4268176) has the molecular formula C30H39NO5 and a molecular weight of 493.64 g/mol. Its IUPAC name is 1-[4a-hydroxy-1-(3,4,5-trimethoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-3-(4-propan-2-ylphenyl)prop-2-en-1-one.
| Compound Name | 1-[4a-hydroxy-1-(3,4,5-trimethoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-3-(4-propan-2-ylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 4268176 |
| Molecular Formula | C30H39NO5 |
| Molecular Weight | 493.64 g/mol |
| Exact Mass | 493.28 |
| IUPAC Name | 1-[4a-hydroxy-1-(3,4,5-trimethoxyphenyl)-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-3-(4-propan-2-ylphenyl)prop-2-en-1-one |
| SMILES | COc1cc(C2C3CCCCC3(O)CCN2C(=O)C=Cc2ccc(C(C)C)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C30H39NO5/c1-20(2)22-12-9-21(10-13-22)11-14-27(32)31-17-16-30(33)15-7-6-8-24(30)28(31)23-18-25(34-3)29(36-5)26(19-23)35-4/h9-14,18-20,24,28,33H,6-8,15-17H2,1-5H3 |
| InChIKey | TXERNGYPWVXFQO-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.64 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|