C27H32FNO5 — CID 40907188
(E)-1-[(1R,4aR,8aS)-1-(4-fluorophenyl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one (PubChem CID 40907188) has the molecular formula C27H32FNO5 and a molecular weight of 469.55 g/mol. Its IUPAC name is (E)-1-[(1R,4aR,8aS)-1-(4-fluorophenyl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[(1R,4aR,8aS)-1-(4-fluorophenyl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 40907188 |
| Molecular Formula | C27H32FNO5 |
| Molecular Weight | 469.55 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | (E)-1-[(1R,4aR,8aS)-1-(4-fluorophenyl)-4a-hydroxy-1,3,4,5,6,7,8,8a-octahydroisoquinolin-2-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cc(/C=C/C(=O)N2CC[C@]3(O)CCCC[C@H]3[C@@H]2c2ccc(F)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C27H32FNO5/c1-32-22-16-18(17-23(33-2)26(22)34-3)7-12-24(30)29-15-14-27(31)13-5-4-6-21(27)25(29)19-8-10-20(28)11-9-19/h7-12,16-17,21,25,31H,4-6,13-15H2,1-3H3/b12-7+/t21-,25-,27+/m0/s1 |
| InChIKey | DNZACJPRGHVVTK-UVAYRQLSSA-N |
| XLogP | 4.76 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.55 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|