C15H22N2O5S — CID 171143631
[7a-(methoxymethyl)-2-methylsulfonyl-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridin-5-yl]-(furan-3-yl)methanone (PubChem CID 171143631) has the molecular formula C15H22N2O5S and a molecular weight of 342.42 g/mol. Its IUPAC name is [7a-(methoxymethyl)-2-methylsulfonyl-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridin-5-yl]-(furan-3-yl)methanone.
| Compound Name | [7a-(methoxymethyl)-2-methylsulfonyl-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridin-5-yl]-(furan-3-yl)methanone |
|---|---|
| PubChem CID | 171143631 |
| Molecular Formula | C15H22N2O5S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | [7a-(methoxymethyl)-2-methylsulfonyl-1,3,3a,4,6,7-hexahydropyrrolo[3,4-c]pyridin-5-yl]-(furan-3-yl)methanone |
| SMILES | COCC12CCN(C(=O)c3ccoc3)CC1CN(S(C)(=O)=O)C2 |
| InChI | InChI=1S/C15H22N2O5S/c1-21-11-15-4-5-16(14(18)12-3-6-22-9-12)7-13(15)8-17(10-15)23(2,19)20/h3,6,9,13H,4-5,7-8,10-11H2,1-2H3 |
| InChIKey | VPLNSRRNKVEKTD-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |