C33H51N7O5 — CID 171146768
(14S,17R)-14-[(2S)-butan-2-yl]-20-[(3,4-dimethoxyphenyl)methyl]-17-methyl-8-(2-methylbut-2-enyl)-1,4,8,13,16,19,21-heptazabicyclo[16.3.0]henicosa-18,20-diene-3,12,15-trione (PubChem CID 171146768) has the molecular formula C33H51N7O5 and a molecular weight of 625.82 g/mol. Its IUPAC name is (14S,17R)-14-[(2S)-butan-2-yl]-20-[(3,4-dimethoxyphenyl)methyl]-17-methyl-8-(2-methylbut-2-enyl)-1,4,8,13,16,19,21-heptazabicyclo[16.3.0]henicosa-18,20-diene-3,12,15-trione.
| Compound Name | (14S,17R)-14-[(2S)-butan-2-yl]-20-[(3,4-dimethoxyphenyl)methyl]-17-methyl-8-(2-methylbut-2-enyl)-1,4,8,13,16,19,21-heptazabicyclo[16.3.0]henicosa-18,20-diene-3,12,15-trione |
|---|---|
| PubChem CID | 171146768 |
| Molecular Formula | C33H51N7O5 |
| Molecular Weight | 625.82 g/mol |
| Exact Mass | 625.40 |
| IUPAC Name | (14S,17R)-14-[(2S)-butan-2-yl]-20-[(3,4-dimethoxyphenyl)methyl]-17-methyl-8-(2-methylbut-2-enyl)-1,4,8,13,16,19,21-heptazabicyclo[16.3.0]henicosa-18,20-diene-3,12,15-trione |
| SMILES | CC=C(C)CN1CCCNC(=O)Cn2nc(Cc3ccc(OC)c(OC)c3)nc2[C@@H](C)NC(=O)[C@H]([C@@H](C)CC)NC(=O)CCC1 |
| InChI | InChI=1S/C33H51N7O5/c1-8-22(3)20-39-16-10-12-29(41)37-31(23(4)9-2)33(43)35-24(5)32-36-28(38-40(32)21-30(42)34-15-11-17-39)19-25-13-14-26(44-6)27(18-25)45-7/h8,13-14,18,23-24,31H,9-12,15-17,19-21H2,1-7H3,(H,34,42)(H,35,43)(H,37,41)/t23-,24+,31-/m0/s1 |
| InChIKey | PSLRIYRJSRUXLD-JLELKNTQSA-N |
| XLogP | 3.16 |
| TPSA | 139.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.82 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|