C16H18F3NO4 — CID 171147048
N-[(3R,4S,5R)-4,5-dihydroxyoxan-3-yl]-N-methyl-3-[3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 171147048) has the molecular formula C16H18F3NO4 and a molecular weight of 345.32 g/mol. Its IUPAC name is N-[(3R,4S,5R)-4,5-dihydroxyoxan-3-yl]-N-methyl-3-[3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | N-[(3R,4S,5R)-4,5-dihydroxyoxan-3-yl]-N-methyl-3-[3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 171147048 |
| Molecular Formula | C16H18F3NO4 |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | N-[(3R,4S,5R)-4,5-dihydroxyoxan-3-yl]-N-methyl-3-[3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | CN(C(=O)C=Cc1cccc(C(F)(F)F)c1)[C@@H]1COC[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C16H18F3NO4/c1-20(12-8-24-9-13(21)15(12)23)14(22)6-5-10-3-2-4-11(7-10)16(17,18)19/h2-7,12-13,15,21,23H,8-9H2,1H3/t12-,13-,15+/m1/s1 |
| InChIKey | UERHQJLCXFQJKE-NFAWXSAZSA-N |
| XLogP | 1.30 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|