C19H26N6OS — CID 171147417
4-(dimethylamino)-1-[4-[[6-(1,3-thiazol-2-ylamino)pyrimidin-4-yl]methyl]piperidin-1-yl]but-2-en-1-one (PubChem CID 171147417) has the molecular formula C19H26N6OS and a molecular weight of 386.53 g/mol. Its IUPAC name is 4-(dimethylamino)-1-[4-[[6-(1,3-thiazol-2-ylamino)pyrimidin-4-yl]methyl]piperidin-1-yl]but-2-en-1-one.
| Compound Name | 4-(dimethylamino)-1-[4-[[6-(1,3-thiazol-2-ylamino)pyrimidin-4-yl]methyl]piperidin-1-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 171147417 |
| Molecular Formula | C19H26N6OS |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | 4-(dimethylamino)-1-[4-[[6-(1,3-thiazol-2-ylamino)pyrimidin-4-yl]methyl]piperidin-1-yl]but-2-en-1-one |
| SMILES | CN(C)CC=CC(=O)N1CCC(Cc2cc(Nc3nccs3)ncn2)CC1 |
| InChI | InChI=1S/C19H26N6OS/c1-24(2)8-3-4-18(26)25-9-5-15(6-10-25)12-16-13-17(22-14-21-16)23-19-20-7-11-27-19/h3-4,7,11,13-15H,5-6,8-10,12H2,1-2H3,(H,20,21,22,23) |
| InChIKey | KQAHZMQMMDVGFO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|