C23H27N5OS — CID 132778709
(E)-4-(dimethylamino)-1-[3-[1-(1,3-thiazol-2-ylamino)isoquinolin-3-yl]piperidin-1-yl]but-2-en-1-one (PubChem CID 132778709) has the molecular formula C23H27N5OS and a molecular weight of 421.57 g/mol. Its IUPAC name is (E)-4-(dimethylamino)-1-[3-[1-(1,3-thiazol-2-ylamino)isoquinolin-3-yl]piperidin-1-yl]but-2-en-1-one.
| Compound Name | (E)-4-(dimethylamino)-1-[3-[1-(1,3-thiazol-2-ylamino)isoquinolin-3-yl]piperidin-1-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 132778709 |
| Molecular Formula | C23H27N5OS |
| Molecular Weight | 421.57 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | (E)-4-(dimethylamino)-1-[3-[1-(1,3-thiazol-2-ylamino)isoquinolin-3-yl]piperidin-1-yl]but-2-en-1-one |
| SMILES | CN(C)C/C=C/C(=O)N1CCCC(c2cc3ccccc3c(Nc3nccs3)n2)C1 |
| InChI | InChI=1S/C23H27N5OS/c1-27(2)12-6-10-21(29)28-13-5-8-18(16-28)20-15-17-7-3-4-9-19(17)22(25-20)26-23-24-11-14-30-23/h3-4,6-7,9-11,14-15,18H,5,8,12-13,16H2,1-2H3,(H,24,25,26)/b10-6+ |
| InChIKey | LVAAAEPTMGVQNX-UXBLZVDNSA-N |
| XLogP | 4.26 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.57 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|