C18H17IN4O2 — CID 171147857
7-iodo-6-methoxy-4-(1-pyridin-2-ylethylamino)quinoline-3-carboxamide (PubChem CID 171147857) has the molecular formula C18H17IN4O2 and a molecular weight of 448.26 g/mol. Its IUPAC name is 7-iodo-6-methoxy-4-(1-pyridin-2-ylethylamino)quinoline-3-carboxamide.
| Compound Name | 7-iodo-6-methoxy-4-(1-pyridin-2-ylethylamino)quinoline-3-carboxamide |
|---|---|
| PubChem CID | 171147857 |
| Molecular Formula | C18H17IN4O2 |
| Molecular Weight | 448.26 g/mol |
| Exact Mass | 448.04 |
| IUPAC Name | 7-iodo-6-methoxy-4-(1-pyridin-2-ylethylamino)quinoline-3-carboxamide |
| SMILES | COc1cc2c(NC(C)c3ccccn3)c(C(N)=O)cnc2cc1I |
| InChI | InChI=1S/C18H17IN4O2/c1-10(14-5-3-4-6-21-14)23-17-11-7-16(25-2)13(19)8-15(11)22-9-12(17)18(20)24/h3-10H,1-2H3,(H2,20,24)(H,22,23) |
| InChIKey | OONTZPYTFXAYID-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.26 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|