C15H14O8 — CID 171148392
(2R,3R)-2-(3,4,5-trihydroxyphenyl)-3,4-dihydrochromene-2,3,5,7-tetrol (PubChem CID 171148392) has the molecular formula C15H14O8 and a molecular weight of 322.27 g/mol. Its IUPAC name is (2R,3R)-2-(3,4,5-trihydroxyphenyl)-3,4-dihydrochromene-2,3,5,7-tetrol.
| Compound Name | (2R,3R)-2-(3,4,5-trihydroxyphenyl)-3,4-dihydrochromene-2,3,5,7-tetrol |
|---|---|
| PubChem CID | 171148392 |
| Molecular Formula | C15H14O8 |
| Molecular Weight | 322.27 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | (2R,3R)-2-(3,4,5-trihydroxyphenyl)-3,4-dihydrochromene-2,3,5,7-tetrol |
| SMILES | Oc1cc(O)c2c(c1)O[C@](O)(c1cc(O)c(O)c(O)c1)[C@H](O)C2 |
| InChI | InChI=1S/C15H14O8/c16-7-3-9(17)8-5-13(20)15(22,23-12(8)4-7)6-1-10(18)14(21)11(19)2-6/h1-4,13,16-22H,5H2/t13-,15-/m1/s1 |
| InChIKey | WQHRFQFSAXMMQJ-UKRRQHHQSA-N |
| XLogP | 0.36 |
| TPSA | 150.84 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.27 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|