C17H18O8 — CID 54127670
2-(3,4-dihydroxyphenyl)-2-(2-hydroxyethoxy)-3,4-dihydrochromene-3,5,7-triol (PubChem CID 54127670) has the molecular formula C17H18O8 and a molecular weight of 350.32 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-2-(2-hydroxyethoxy)-3,4-dihydrochromene-3,5,7-triol.
| Compound Name | 2-(3,4-dihydroxyphenyl)-2-(2-hydroxyethoxy)-3,4-dihydrochromene-3,5,7-triol |
|---|---|
| PubChem CID | 54127670 |
| Molecular Formula | C17H18O8 |
| Molecular Weight | 350.32 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-2-(2-hydroxyethoxy)-3,4-dihydrochromene-3,5,7-triol |
| SMILES | OCCOC1(c2ccc(O)c(O)c2)Oc2cc(O)cc(O)c2CC1O |
| InChI | InChI=1S/C17H18O8/c18-3-4-24-17(9-1-2-12(20)14(22)5-9)16(23)8-11-13(21)6-10(19)7-15(11)25-17/h1-2,5-7,16,18-23H,3-4,8H2 |
| InChIKey | NSDAPWLLTHNBJQ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 139.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.32 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|