C14H20O4 — CID 155020433
(3S)-2-ethyl-2-propan-2-yl-3,4-dihydrochromene-3,5,7-triol (PubChem CID 155020433) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is (3S)-2-ethyl-2-propan-2-yl-3,4-dihydrochromene-3,5,7-triol.
| Compound Name | (3S)-2-ethyl-2-propan-2-yl-3,4-dihydrochromene-3,5,7-triol |
|---|---|
| PubChem CID | 155020433 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | (3S)-2-ethyl-2-propan-2-yl-3,4-dihydrochromene-3,5,7-triol |
| SMILES | CCC1(C(C)C)Oc2cc(O)cc(O)c2C[C@@H]1O |
| InChI | InChI=1S/C14H20O4/c1-4-14(8(2)3)13(17)7-10-11(16)5-9(15)6-12(10)18-14/h5-6,8,13,15-17H,4,7H2,1-3H3/t13-,14?/m0/s1 |
| InChIKey | JOBHIUJBNXNRLX-LSLKUGRBSA-N |
| XLogP | 2.20 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |