C19H29N5O4S — CID 171155685
N-[[(3S,7S,8aS)-7-(methanesulfonamido)-4-oxo-2-(pyridin-2-ylmethyl)-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-3-yl]methyl]-2-methylpropanamide (PubChem CID 171155685) has the molecular formula C19H29N5O4S and a molecular weight of 423.54 g/mol. Its IUPAC name is N-[[(3S,7S,8aS)-7-(methanesulfonamido)-4-oxo-2-(pyridin-2-ylmethyl)-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-3-yl]methyl]-2-methylpropanamide.
| Compound Name | N-[[(3S,7S,8aS)-7-(methanesulfonamido)-4-oxo-2-(pyridin-2-ylmethyl)-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-3-yl]methyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 171155685 |
| Molecular Formula | C19H29N5O4S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | N-[[(3S,7S,8aS)-7-(methanesulfonamido)-4-oxo-2-(pyridin-2-ylmethyl)-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-3-yl]methyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)NC[C@H]1C(=O)N2C[C@@H](NS(C)(=O)=O)C[C@H]2CN1Cc1ccccn1 |
| InChI | InChI=1S/C19H29N5O4S/c1-13(2)18(25)21-9-17-19(26)24-11-15(22-29(3,27)28)8-16(24)12-23(17)10-14-6-4-5-7-20-14/h4-7,13,15-17,22H,8-12H2,1-3H3,(H,21,25)/t15-,16-,17-/m0/s1 |
| InChIKey | NUMGAYROZSZCSP-ULQDDVLXSA-N |
| XLogP | -0.44 |
| TPSA | 111.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |