C25H32N6O3 — CID 171155768
N-[[(3S,7S,8aS)-4-oxo-7-(propan-2-ylcarbamoylamino)-2-(pyridin-2-ylmethyl)-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-3-yl]methyl]benzamide (PubChem CID 171155768) has the molecular formula C25H32N6O3 and a molecular weight of 464.57 g/mol. Its IUPAC name is N-[[(3S,7S,8aS)-4-oxo-7-(propan-2-ylcarbamoylamino)-2-(pyridin-2-ylmethyl)-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-3-yl]methyl]benzamide.
| Compound Name | N-[[(3S,7S,8aS)-4-oxo-7-(propan-2-ylcarbamoylamino)-2-(pyridin-2-ylmethyl)-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 171155768 |
| Molecular Formula | C25H32N6O3 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.25 |
| IUPAC Name | N-[[(3S,7S,8aS)-4-oxo-7-(propan-2-ylcarbamoylamino)-2-(pyridin-2-ylmethyl)-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-3-yl]methyl]benzamide |
| SMILES | CC(C)NC(=O)N[C@H]1C[C@H]2CN(Cc3ccccn3)[C@@H](CNC(=O)c3ccccc3)C(=O)N2C1 |
| InChI | InChI=1S/C25H32N6O3/c1-17(2)28-25(34)29-20-12-21-16-30(14-19-10-6-7-11-26-19)22(24(33)31(21)15-20)13-27-23(32)18-8-4-3-5-9-18/h3-11,17,20-22H,12-16H2,1-2H3,(H,27,32)(H2,28,29,34)/t20-,21-,22-/m0/s1 |
| InChIKey | SUPBXZCWWKZWEO-FKBYEOEOSA-N |
| XLogP | 1.37 |
| TPSA | 106.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |