C20H31N5O4S — CID 171155630
N-[[(3S,7S,8aS)-4-oxo-7-(propan-2-ylcarbamoylamino)-2-(thiophen-3-ylmethyl)-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-3-yl]methyl]-2-methoxyacetamide (PubChem CID 171155630) has the molecular formula C20H31N5O4S and a molecular weight of 437.57 g/mol. Its IUPAC name is N-[[(3S,7S,8aS)-4-oxo-7-(propan-2-ylcarbamoylamino)-2-(thiophen-3-ylmethyl)-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-3-yl]methyl]-2-methoxyacetamide.
| Compound Name | N-[[(3S,7S,8aS)-4-oxo-7-(propan-2-ylcarbamoylamino)-2-(thiophen-3-ylmethyl)-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-3-yl]methyl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 171155630 |
| Molecular Formula | C20H31N5O4S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | N-[[(3S,7S,8aS)-4-oxo-7-(propan-2-ylcarbamoylamino)-2-(thiophen-3-ylmethyl)-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-3-yl]methyl]-2-methoxyacetamide |
| SMILES | COCC(=O)NC[C@H]1C(=O)N2C[C@@H](NC(=O)NC(C)C)C[C@H]2CN1Cc1ccsc1 |
| InChI | InChI=1S/C20H31N5O4S/c1-13(2)22-20(28)23-15-6-16-10-24(8-14-4-5-30-12-14)17(19(27)25(16)9-15)7-21-18(26)11-29-3/h4-5,12-13,15-17H,6-11H2,1-3H3,(H,21,26)(H2,22,23,28)/t15-,16-,17-/m0/s1 |
| InChIKey | SHYANTKESYPUTB-ULQDDVLXSA-N |
| XLogP | 0.37 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |