C24H31N5O3S — CID 171155792
N-[[(3S,7S,8aS)-4-oxo-7-(propan-2-ylcarbamoylamino)-2-(thiophen-2-ylmethyl)-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-3-yl]methyl]benzamide (PubChem CID 171155792) has the molecular formula C24H31N5O3S and a molecular weight of 469.61 g/mol. Its IUPAC name is N-[[(3S,7S,8aS)-4-oxo-7-(propan-2-ylcarbamoylamino)-2-(thiophen-2-ylmethyl)-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-3-yl]methyl]benzamide.
| Compound Name | N-[[(3S,7S,8aS)-4-oxo-7-(propan-2-ylcarbamoylamino)-2-(thiophen-2-ylmethyl)-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 171155792 |
| Molecular Formula | C24H31N5O3S |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | N-[[(3S,7S,8aS)-4-oxo-7-(propan-2-ylcarbamoylamino)-2-(thiophen-2-ylmethyl)-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-3-yl]methyl]benzamide |
| SMILES | CC(C)NC(=O)N[C@H]1C[C@H]2CN(Cc3cccs3)[C@@H](CNC(=O)c3ccccc3)C(=O)N2C1 |
| InChI | InChI=1S/C24H31N5O3S/c1-16(2)26-24(32)27-18-11-19-14-28(15-20-9-6-10-33-20)21(23(31)29(19)13-18)12-25-22(30)17-7-4-3-5-8-17/h3-10,16,18-19,21H,11-15H2,1-2H3,(H,25,30)(H2,26,27,32)/t18-,19-,21-/m0/s1 |
| InChIKey | DZBNQMMRRULQJZ-ZJOUEHCJSA-N |
| XLogP | 2.04 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |