C30H30N2O3 — CID 171157008
(9R)-N,N-dibenzyl-9-methyl-11-oxo-10-prop-2-enyl-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-12-carboxamide (PubChem CID 171157008) has the molecular formula C30H30N2O3 and a molecular weight of 466.58 g/mol. Its IUPAC name is (9R)-N,N-dibenzyl-9-methyl-11-oxo-10-prop-2-enyl-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-12-carboxamide.
| Compound Name | (9R)-N,N-dibenzyl-9-methyl-11-oxo-10-prop-2-enyl-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-12-carboxamide |
|---|---|
| PubChem CID | 171157008 |
| Molecular Formula | C30H30N2O3 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.23 |
| IUPAC Name | (9R)-N,N-dibenzyl-9-methyl-11-oxo-10-prop-2-enyl-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-12-carboxamide |
| SMILES | C=CCN1C(=O)C(C(=O)N(Cc2ccccc2)Cc2ccccc2)C2C[C@@]1(C)Oc1ccccc12 |
| InChI | InChI=1S/C30H30N2O3/c1-3-18-32-29(34)27(25-19-30(32,2)35-26-17-11-10-16-24(25)26)28(33)31(20-22-12-6-4-7-13-22)21-23-14-8-5-9-15-23/h3-17,25,27H,1,18-21H2,2H3/t25?,27?,30-/m1/s1 |
| InChIKey | VAFWBYSCBKSCKY-AEXFLSAISA-N |
| XLogP | 5.14 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|