C27H18Cl2N2O2S — CID 17116628
N-[2-(1,3-benzothiazol-2-yl)-4,6-dichlorophenyl]-3-phenylmethoxybenzamide (PubChem CID 17116628) has the molecular formula C27H18Cl2N2O2S and a molecular weight of 505.43 g/mol. Its IUPAC name is N-[2-(1,3-benzothiazol-2-yl)-4,6-dichlorophenyl]-3-phenylmethoxybenzamide.
| Compound Name | N-[2-(1,3-benzothiazol-2-yl)-4,6-dichlorophenyl]-3-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 17116628 |
| Molecular Formula | C27H18Cl2N2O2S |
| Molecular Weight | 505.43 g/mol |
| Exact Mass | 504.05 |
| IUPAC Name | N-[2-(1,3-benzothiazol-2-yl)-4,6-dichlorophenyl]-3-phenylmethoxybenzamide |
| SMILES | O=C(Nc1c(Cl)cc(Cl)cc1-c1nc2ccccc2s1)c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C27H18Cl2N2O2S/c28-19-14-21(27-30-23-11-4-5-12-24(23)34-27)25(22(29)15-19)31-26(32)18-9-6-10-20(13-18)33-16-17-7-2-1-3-8-17/h1-15H,16H2,(H,31,32) |
| InChIKey | QQFVVRJHMRJICY-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.43 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |