C12H16BrClF2N2 — CID 171170440
1-[(1R)-1-(4-bromo-2,6-difluorophenyl)ethyl]piperazine;hydrochloride (PubChem CID 171170440) has the molecular formula C12H16BrClF2N2 and a molecular weight of 341.63 g/mol. Its IUPAC name is 1-[(1R)-1-(4-bromo-2,6-difluorophenyl)ethyl]piperazine;hydrochloride.
| Compound Name | 1-[(1R)-1-(4-bromo-2,6-difluorophenyl)ethyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171170440 |
| Molecular Formula | C12H16BrClF2N2 |
| Molecular Weight | 341.63 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | 1-[(1R)-1-(4-bromo-2,6-difluorophenyl)ethyl]piperazine;hydrochloride |
| SMILES | C[C@H](c1c(F)cc(Br)cc1F)N1CCNCC1.Cl |
| InChI | InChI=1S/C12H15BrF2N2.ClH/c1-8(17-4-2-16-3-5-17)12-10(14)6-9(13)7-11(12)15;/h6-8,16H,2-5H2,1H3;1H/t8-;/m1./s1 |
| InChIKey | NENJGLBEACQUIA-DDWIOCJRSA-N |
| XLogP | 3.12 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.63 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |