C15H15Cl3F2N2S — CID 171177115
1-[(S)-(2-chloro-3,6-difluorophenyl)-(5-chlorothiophen-2-yl)methyl]piperazine;hydrochloride (PubChem CID 171177115) has the molecular formula C15H15Cl3F2N2S and a molecular weight of 399.72 g/mol. Its IUPAC name is 1-[(S)-(2-chloro-3,6-difluorophenyl)-(5-chlorothiophen-2-yl)methyl]piperazine;hydrochloride.
| Compound Name | 1-[(S)-(2-chloro-3,6-difluorophenyl)-(5-chlorothiophen-2-yl)methyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171177115 |
| Molecular Formula | C15H15Cl3F2N2S |
| Molecular Weight | 399.72 g/mol |
| Exact Mass | 398.00 |
| IUPAC Name | 1-[(S)-(2-chloro-3,6-difluorophenyl)-(5-chlorothiophen-2-yl)methyl]piperazine;hydrochloride |
| SMILES | Cl.Fc1ccc(F)c([C@@H](c2ccc(Cl)s2)N2CCNCC2)c1Cl |
| InChI | InChI=1S/C15H14Cl2F2N2S.ClH/c16-12-4-3-11(22-12)15(21-7-5-20-6-8-21)13-9(18)1-2-10(19)14(13)17;/h1-4,15,20H,5-8H2;1H/t15-;/m1./s1 |
| InChIKey | NFSGXVUSEVWJKR-XFULWGLBSA-N |
| XLogP | 4.75 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.72 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|