C15H15Cl4FN2S — CID 171181447
1-[(R)-(5-chlorothiophen-2-yl)-(3,6-dichloro-2-fluorophenyl)methyl]piperazine;hydrochloride (PubChem CID 171181447) has the molecular formula C15H15Cl4FN2S and a molecular weight of 416.18 g/mol. Its IUPAC name is 1-[(R)-(5-chlorothiophen-2-yl)-(3,6-dichloro-2-fluorophenyl)methyl]piperazine;hydrochloride.
| Compound Name | 1-[(R)-(5-chlorothiophen-2-yl)-(3,6-dichloro-2-fluorophenyl)methyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171181447 |
| Molecular Formula | C15H15Cl4FN2S |
| Molecular Weight | 416.18 g/mol |
| Exact Mass | 413.97 |
| IUPAC Name | 1-[(R)-(5-chlorothiophen-2-yl)-(3,6-dichloro-2-fluorophenyl)methyl]piperazine;hydrochloride |
| SMILES | Cl.Fc1c(Cl)ccc(Cl)c1[C@H](c1ccc(Cl)s1)N1CCNCC1 |
| InChI | InChI=1S/C15H14Cl3FN2S.ClH/c16-9-1-2-10(17)14(19)13(9)15(11-3-4-12(18)22-11)21-7-5-20-6-8-21;/h1-4,15,20H,5-8H2;1H/t15-;/m0./s1 |
| InChIKey | LPJQOGYHACDJGN-RSAXXLAASA-N |
| XLogP | 5.26 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.18 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|