C15H16Cl3FN2O — CID 171178008
1-[(S)-(3,6-dichloro-2-fluorophenyl)-(furan-2-yl)methyl]piperazine;hydrochloride (PubChem CID 171178008) has the molecular formula C15H16Cl3FN2O and a molecular weight of 365.66 g/mol. Its IUPAC name is 1-[(S)-(3,6-dichloro-2-fluorophenyl)-(furan-2-yl)methyl]piperazine;hydrochloride.
| Compound Name | 1-[(S)-(3,6-dichloro-2-fluorophenyl)-(furan-2-yl)methyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171178008 |
| Molecular Formula | C15H16Cl3FN2O |
| Molecular Weight | 365.66 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | 1-[(S)-(3,6-dichloro-2-fluorophenyl)-(furan-2-yl)methyl]piperazine;hydrochloride |
| SMILES | Cl.Fc1c(Cl)ccc(Cl)c1[C@@H](c1ccco1)N1CCNCC1 |
| InChI | InChI=1S/C15H15Cl2FN2O.ClH/c16-10-3-4-11(17)14(18)13(10)15(12-2-1-9-21-12)20-7-5-19-6-8-20;/h1-4,9,15,19H,5-8H2;1H/t15-;/m1./s1 |
| InChIKey | VNGLHHGJAWGVFY-XFULWGLBSA-N |
| XLogP | 4.14 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.66 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|