C13H17ClF2I2N2O2 — CID 171181463
2-[(1R)-2,2-difluoro-3-hydroxy-1-piperazin-1-ylpropyl]-4,6-diiodophenol;hydrochloride (PubChem CID 171181463) has the molecular formula C13H17ClF2I2N2O2 and a molecular weight of 560.55 g/mol. Its IUPAC name is 2-[(1R)-2,2-difluoro-3-hydroxy-1-piperazin-1-ylpropyl]-4,6-diiodophenol;hydrochloride.
| Compound Name | 2-[(1R)-2,2-difluoro-3-hydroxy-1-piperazin-1-ylpropyl]-4,6-diiodophenol;hydrochloride |
|---|---|
| PubChem CID | 171181463 |
| Molecular Formula | C13H17ClF2I2N2O2 |
| Molecular Weight | 560.55 g/mol |
| Exact Mass | 559.90 |
| IUPAC Name | 2-[(1R)-2,2-difluoro-3-hydroxy-1-piperazin-1-ylpropyl]-4,6-diiodophenol;hydrochloride |
| SMILES | Cl.OCC(F)(F)[C@@H](c1cc(I)cc(I)c1O)N1CCNCC1 |
| InChI | InChI=1S/C13H16F2I2N2O2.ClH/c14-13(15,7-20)12(19-3-1-18-2-4-19)9-5-8(16)6-10(17)11(9)21;/h5-6,12,18,20-21H,1-4,7H2;1H/t12-;/m1./s1 |
| InChIKey | SABAVCOAFCQTMF-UTONKHPSSA-N |
| XLogP | 2.60 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.55 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|