C17H15N3O3S — CID 17118331
3-[(E)-(3-hydroxy-4-methoxyphenyl)methylideneamino]-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 17118331) has the molecular formula C17H15N3O3S and a molecular weight of 341.39 g/mol. Its IUPAC name is 3-[(E)-(3-hydroxy-4-methoxyphenyl)methylideneamino]-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | 3-[(E)-(3-hydroxy-4-methoxyphenyl)methylideneamino]-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 17118331 |
| Molecular Formula | C17H15N3O3S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | 3-[(E)-(3-hydroxy-4-methoxyphenyl)methylideneamino]-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(/C=N/N2C(=O)CS/C2=N\c2ccccc2)cc1O |
| InChI | InChI=1S/C17H15N3O3S/c1-23-15-8-7-12(9-14(15)21)10-18-20-16(22)11-24-17(20)19-13-5-3-2-4-6-13/h2-10,21H,11H2,1H3/b18-10+,19-17- |
| InChIKey | KTNTULUIHKWSGT-MNVAPZAZSA-N |
| XLogP | 3.00 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|