C18H14N3O4S- — CID 6978844
2-[(Z)-[2-(2-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-3-yl]iminomethyl]benzoate (PubChem CID 6978844) has the molecular formula C18H14N3O4S- and a molecular weight of 368.39 g/mol. Its IUPAC name is 2-[(Z)-[2-(2-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-3-yl]iminomethyl]benzoate.
| Compound Name | 2-[(Z)-[2-(2-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-3-yl]iminomethyl]benzoate |
|---|---|
| PubChem CID | 6978844 |
| Molecular Formula | C18H14N3O4S- |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | 2-[(Z)-[2-(2-methoxyphenyl)imino-4-oxo-1,3-thiazolidin-3-yl]iminomethyl]benzoate |
| SMILES | COc1ccccc1/N=C1\SCC(=O)N1/N=C\c1ccccc1C(=O)[O-] |
| InChI | InChI=1S/C18H15N3O4S/c1-25-15-9-5-4-8-14(15)20-18-21(16(22)11-26-18)19-10-12-6-2-3-7-13(12)17(23)24/h2-10H,11H2,1H3,(H,23,24)/p-1/b19-10-,20-18- |
| InChIKey | DOQYWFJZQVHFDC-DUASSGOGSA-M |
| XLogP | 1.66 |
| TPSA | 94.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|